C13H31NO — CID 144672608
(2Z)-3-(2-aminoethyl)penta-2,4-dien-2-ol;ethane (PubChem CID 144672608) has the molecular formula C13H31NO and a molecular weight of 217.40 g/mol. Its IUPAC name is (2Z)-3-(2-aminoethyl)penta-2,4-dien-2-ol;ethane.
| Compound Name | (2Z)-3-(2-aminoethyl)penta-2,4-dien-2-ol;ethane |
|---|---|
| PubChem CID | 144672608 |
| Molecular Formula | C13H31NO |
| Molecular Weight | 217.40 g/mol |
| Exact Mass | 217.24 |
| IUPAC Name | (2Z)-3-(2-aminoethyl)penta-2,4-dien-2-ol;ethane |
| SMILES | C=C/C(CCN)=C(/C)O.CC.CC.CC |
| InChI | InChI=1S/C7H13NO.3C2H6/c1-3-7(4-5-8)6(2)9;3*1-2/h3,9H,1,4-5,8H2,2H3;3*1-2H3/b7-6+;;; |
| InChIKey | YPVGPURCGPAVMP-ZMVRRDJGSA-N |
| XLogP | 4.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|