C19H22BrNO3 — CID 144676607
methyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-methoxyacetate (PubChem CID 144676607) has the molecular formula C19H22BrNO3 and a molecular weight of 392.29 g/mol. Its IUPAC name is methyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-methoxyacetate.
| Compound Name | methyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-methoxyacetate |
|---|---|
| PubChem CID | 144676607 |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | methyl (2S)-2-[3-amino-4-bromo-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-methoxyacetate |
| SMILES | COC(=O)[C@@H](OC)c1c(C)c(N)c(Br)c(C)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22BrNO3/c1-10-6-8-13(9-7-10)14-11(2)16(20)17(21)12(3)15(14)18(23-4)19(22)24-5/h6-9,18H,21H2,1-5H3/t18-/m0/s1 |
| InChIKey | FUOVGXUSHYOQNW-SFHVURJKSA-N |
| XLogP | 4.48 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|