About 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate
3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate (PubChem CID 144680202) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate.
Molecular Properties
| Compound Name | 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate |
| PubChem CID | 144680202 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate |
| SMILES | CCC(O)CCOC(/C=C\C(C)=O)=N\C |
| InChI | InChI=1S/C11H19NO3/c1-4-10(14)7-8-15-11(12-3)6-5-9(2)13/h5-6,10,14H,4,7-8H2,1-3H3/b6-5-,12-11- |
| InChIKey | WYRIAESRVWLKIH-KSIKAEMPSA-N |
| XLogP | 1.34 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate?
The IUPAC name of 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate (CID 144680202) is 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate.
What is the SMILES notation for 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate?
The canonical SMILES for 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate is CCC(O)CCOC(/C=C\C(C)=O)=N\C.
What is the InChIKey of 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate?
The InChIKey is WYRIAESRVWLKIH-KSIKAEMPSA-N. The full InChI is InChI=1S/C11H19NO3/c1-4-10(14)7-8-15-11(12-3)6-5-9(2)13/h5-6,10,14H,4,7-8H2,1-3H3/b6-5-,12-11-.
What are the key properties of 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate?
3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate has a molecular weight of 213.28 g/mol, XLogP of 1.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypentyl (Z)-N-methyl-4-oxopent-2-enimidate is sourced from PubChem (CID 144680202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).