C15H31NO6S — CID 144687491
carbamic acid;[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] butanoate;thiane (PubChem CID 144687491) has the molecular formula C15H31NO6S and a molecular weight of 353.48 g/mol. Its IUPAC name is carbamic acid;[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] butanoate;thiane.
| Compound Name | carbamic acid;[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] butanoate;thiane |
|---|---|
| PubChem CID | 144687491 |
| Molecular Formula | C15H31NO6S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | carbamic acid;[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] butanoate;thiane |
| SMILES | C1CCSCC1.CCCC(=O)OCC(C)(CO)CO.NC(=O)O |
| InChI | InChI=1S/C9H18O4.C5H10S.CH3NO2/c1-3-4-8(12)13-7-9(2,5-10)6-11;1-2-4-6-5-3-1;2-1(3)4/h10-11H,3-7H2,1-2H3;1-5H2;2H2,(H,3,4) |
| InChIKey | DNFJECMCIZKFPG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |