About (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene
(2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene (PubChem CID 144688089) has the molecular formula C24H25Br2NO2
and a molecular weight of 519.28 g/mol. Its IUPAC name is (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene.
Molecular Properties
| Compound Name | (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene |
| PubChem CID | 144688089 |
| Molecular Formula | C24H25Br2NO2 |
| Molecular Weight | 519.28 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene |
| SMILES | Brc1ccccc1.Brc1ccccc1.CN1CCO[C@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C12H15NO2.2C6H5Br/c1-13-7-8-15-11(12(13)14)9-10-5-3-2-4-6-10;2*7-6-4-2-1-3-5-6/h2-6,11H,7-9H2,1H3;2*1-5H/t11-;;/m1../s1 |
| InChIKey | VDXNGPAFERXPBS-NVJADKKVSA-N |
| XLogP | 5.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.28 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene?
The IUPAC name of (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene (CID 144688089) is (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene.
What is the SMILES notation for (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene?
The canonical SMILES for (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene is Brc1ccccc1.Brc1ccccc1.CN1CCO[C@H](Cc2ccccc2)C1=O.
What is the InChIKey of (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene?
The InChIKey is VDXNGPAFERXPBS-NVJADKKVSA-N. The full InChI is InChI=1S/C12H15NO2.2C6H5Br/c1-13-7-8-15-11(12(13)14)9-10-5-3-2-4-6-10;2*7-6-4-2-1-3-5-6/h2-6,11H,7-9H2,1H3;2*1-5H/t11-;;/m1../s1.
What are the key properties of (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene?
(2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene has a molecular weight of 519.28 g/mol, XLogP of 5.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-benzyl-4-methylmorpholin-3-one;bromobenzene is sourced from PubChem (CID 144688089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).