C50H66F5O4S3+ — CID 144690517
1,5-dicyclohexyl-3-hexan-3-yl-2-methoxybenzene;(5-methoxy-2-methylphenyl)-bis(3-methoxyphenyl)sulfanium;1,1,2,2,3-pentafluoropropane-1,3-dithiol (PubChem CID 144690517) has the molecular formula C50H66F5O4S3+ and a molecular weight of 922.26 g/mol. Its IUPAC name is 1,5-dicyclohexyl-3-hexan-3-yl-2-methoxybenzene;(5-methoxy-2-methylphenyl)-bis(3-methoxyphenyl)sulfanium;1,1,2,2,3-pentafluoropropane-1,3-dithiol.
| Compound Name | 1,5-dicyclohexyl-3-hexan-3-yl-2-methoxybenzene;(5-methoxy-2-methylphenyl)-bis(3-methoxyphenyl)sulfanium;1,1,2,2,3-pentafluoropropane-1,3-dithiol |
|---|---|
| PubChem CID | 144690517 |
| Molecular Formula | C50H66F5O4S3+ |
| Molecular Weight | 922.26 g/mol |
| Exact Mass | 921.40 |
| IUPAC Name | 1,5-dicyclohexyl-3-hexan-3-yl-2-methoxybenzene;(5-methoxy-2-methylphenyl)-bis(3-methoxyphenyl)sulfanium;1,1,2,2,3-pentafluoropropane-1,3-dithiol |
| SMILES | CCCC(CC)c1cc(C2CCCCC2)cc(C2CCCCC2)c1OC.COc1cccc([S+](c2cccc(OC)c2)c2cc(OC)ccc2C)c1.FC(S)C(F)(F)C(F)(F)S |
| InChI | InChI=1S/C25H40O.C22H23O3S.C3H3F5S2/c1-4-12-19(5-2)23-17-22(20-13-8-6-9-14-20)18-24(25(23)26-3)21-15-10-7-11-16-21;1-16-11-12-19(25-4)15-22(16)26(20-9-5-7-17(13-20)23-2)21-10-6-8-18(14-21)24-3;4-1(9)2(5,6)3(7,8)10/h17-21H,4-16H2,1-3H3;5-15H,1-4H3;1,9-10H/q;+1; |
| InChIKey | GVFSKILIAORDDE-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.26 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|