C10H11NS — CID 144690843
4-(2,5-dihydropyrrol-1-yl)benzenethiol (PubChem CID 144690843) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 4-(2,5-dihydropyrrol-1-yl)benzenethiol.
| Compound Name | 4-(2,5-dihydropyrrol-1-yl)benzenethiol |
|---|---|
| PubChem CID | 144690843 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 4-(2,5-dihydropyrrol-1-yl)benzenethiol |
| SMILES | Sc1ccc(N2CC=CC2)cc1 |
| InChI | InChI=1S/C10H11NS/c12-10-5-3-9(4-6-10)11-7-1-2-8-11/h1-6,12H,7-8H2 |
| InChIKey | XXZJGAYYHCTVCY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|