C8H12N4 — CID 144691488
(1E)-1-(2,5-dimethyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-amine (PubChem CID 144691488) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is (1E)-1-(2,5-dimethyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-amine.
| Compound Name | (1E)-1-(2,5-dimethyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 144691488 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | (1E)-1-(2,5-dimethyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-amine |
| SMILES | C=C/C(N)=C\c1nc(C)nn1C |
| InChI | InChI=1S/C8H12N4/c1-4-7(9)5-8-10-6(2)11-12(8)3/h4-5H,1,9H2,2-3H3/b7-5+ |
| InChIKey | YWFQPYVUWJCPGH-FNORWQNLSA-N |
| XLogP | 0.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|