C10H17N5 — CID 148687835
1-[(1Z)-3-aminobuta-1,3-dienyl]-5-ethyl-N,N-dimethyl-1,2,4-triazol-3-amine (PubChem CID 148687835) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-[(1Z)-3-aminobuta-1,3-dienyl]-5-ethyl-N,N-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 1-[(1Z)-3-aminobuta-1,3-dienyl]-5-ethyl-N,N-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 148687835 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-[(1Z)-3-aminobuta-1,3-dienyl]-5-ethyl-N,N-dimethyl-1,2,4-triazol-3-amine |
| SMILES | C=C(N)/C=C\n1nc(N(C)C)nc1CC |
| InChI | InChI=1S/C10H17N5/c1-5-9-12-10(14(3)4)13-15(9)7-6-8(2)11/h6-7H,2,5,11H2,1,3-4H3/b7-6- |
| InChIKey | NSWAEVILFGAPAR-SREVYHEPSA-N |
| XLogP | 0.85 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|