C7H13N3O3 — CID 144695972
formamide;6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 144695972) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is formamide;6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | formamide;6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 144695972 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | formamide;6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | NC=O.O=C1N2CCCC(C2)N1O |
| InChI | InChI=1S/C6H10N2O2.CH3NO/c9-6-7-3-1-2-5(4-7)8(6)10;2-1-3/h5,10H,1-4H2;1H,(H2,2,3) |
| InChIKey | QYPXIMSUIKGKDW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|