C23H25FN6O2S — CID 144697842
4-(2-fluoro-4-methoxy-3-pyridinyl)-2-[2-(4-methylsulfinylpiperazin-1-yl)pyridine-4-carboximidoyl]aniline (PubChem CID 144697842) has the molecular formula C23H25FN6O2S and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-(2-fluoro-4-methoxy-3-pyridinyl)-2-[2-(4-methylsulfinylpiperazin-1-yl)pyridine-4-carboximidoyl]aniline.
| Compound Name | 4-(2-fluoro-4-methoxy-3-pyridinyl)-2-[2-(4-methylsulfinylpiperazin-1-yl)pyridine-4-carboximidoyl]aniline |
|---|---|
| PubChem CID | 144697842 |
| Molecular Formula | C23H25FN6O2S |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 4-(2-fluoro-4-methoxy-3-pyridinyl)-2-[2-(4-methylsulfinylpiperazin-1-yl)pyridine-4-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1ccnc(N2CCN(S(C)=O)CC2)c1)c1cc(-c2c(OC)ccnc2F)ccc1N |
| InChI | InChI=1S/C23H25FN6O2S/c1-32-19-6-8-28-23(24)21(19)15-3-4-18(25)17(13-15)22(26)16-5-7-27-20(14-16)29-9-11-30(12-10-29)33(2)31/h3-8,13-14,26H,9-12,25H2,1-2H3/b26-22+ |
| InChIKey | ZTNQAXAFJZQELB-XTCLZLMSSA-N |
| XLogP | 2.71 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|