About 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane
4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane (PubChem CID 144700540) has the molecular formula C17H19ClN2O3
and a molecular weight of 334.80 g/mol. Its IUPAC name is 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane.
Molecular Properties
| Compound Name | 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane |
| PubChem CID | 144700540 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane |
| SMILES | COC.COc1cc(C=O)cc(/C=C/c2cnc(C)nc2)c1Cl |
| InChI | InChI=1S/C15H13ClN2O2.C2H6O/c1-10-17-7-11(8-18-10)3-4-13-5-12(9-19)6-14(20-2)15(13)16;1-3-2/h3-9H,1-2H3;1-2H3/b4-3+; |
| InChIKey | YPJRUIAERDBDSZ-BJILWQEISA-N |
| XLogP | 3.69 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane?
The IUPAC name of 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane (CID 144700540) is 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane.
What is the SMILES notation for 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane?
The canonical SMILES for 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane is COC.COc1cc(C=O)cc(/C=C/c2cnc(C)nc2)c1Cl.
What is the InChIKey of 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane?
The InChIKey is YPJRUIAERDBDSZ-BJILWQEISA-N. The full InChI is InChI=1S/C15H13ClN2O2.C2H6O/c1-10-17-7-11(8-18-10)3-4-13-5-12(9-19)6-14(20-2)15(13)16;1-3-2/h3-9H,1-2H3;1-2H3/b4-3+;.
What are the key properties of 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane?
4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane has a molecular weight of 334.80 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methoxy-5-[(E)-2-(2-methylpyrimidin-5-yl)ethenyl]benzaldehyde;methoxymethane is sourced from PubChem (CID 144700540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).