C8H14FN — CID 144703102
(Z,2Z)-2-(1-fluoroethylidene)hex-3-en-1-amine (PubChem CID 144703102) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is (Z,2Z)-2-(1-fluoroethylidene)hex-3-en-1-amine.
| Compound Name | (Z,2Z)-2-(1-fluoroethylidene)hex-3-en-1-amine |
|---|---|
| PubChem CID | 144703102 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (Z,2Z)-2-(1-fluoroethylidene)hex-3-en-1-amine |
| SMILES | CC/C=C\C(CN)=C(/C)F |
| InChI | InChI=1S/C8H14FN/c1-3-4-5-8(6-10)7(2)9/h4-5H,3,6,10H2,1-2H3/b5-4-,8-7- |
| InChIKey | SQBXNUQICADFPJ-UTOQUPLUSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|