C16H7N3O7 — CID 144704820
3,6,8-trinitropyren-1-ol (PubChem CID 144704820) has the molecular formula C16H7N3O7 and a molecular weight of 353.25 g/mol. Its IUPAC name is 3,6,8-trinitropyren-1-ol.
| Compound Name | 3,6,8-trinitropyren-1-ol |
|---|---|
| PubChem CID | 144704820 |
| Molecular Formula | C16H7N3O7 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 3,6,8-trinitropyren-1-ol |
| SMILES | O=[N+]([O-])c1cc(O)c2ccc3c([N+](=O)[O-])cc([N+](=O)[O-])c4ccc1c2c34 |
| InChI | InChI=1S/C16H7N3O7/c20-14-6-13(19(25)26)9-2-1-7-11(17(21)22)5-12(18(23)24)8-3-4-10(14)16(9)15(7)8/h1-6,20H |
| InChIKey | LHNBTEWLNWUSBB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|