C19H26N4O4+2 — CID 144707444
7-benzyl-8-ethoxy-3-ethyl-2-hydroxy-1-(3-hydroxypropyl)-9H-purine-3,7-diium-6-one (PubChem CID 144707444) has the molecular formula C19H26N4O4+2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 7-benzyl-8-ethoxy-3-ethyl-2-hydroxy-1-(3-hydroxypropyl)-9H-purine-3,7-diium-6-one.
| Compound Name | 7-benzyl-8-ethoxy-3-ethyl-2-hydroxy-1-(3-hydroxypropyl)-9H-purine-3,7-diium-6-one |
|---|---|
| PubChem CID | 144707444 |
| Molecular Formula | C19H26N4O4+2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 7-benzyl-8-ethoxy-3-ethyl-2-hydroxy-1-(3-hydroxypropyl)-9H-purine-3,7-diium-6-one |
| SMILES | CCOc1[nH]c2c(c(=O)n(CCCO)c(O)[n+]2CC)[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N4O4/c1-3-21-16-15(17(25)22(19(21)26)11-8-12-24)23(18(20-16)27-4-2)13-14-9-6-5-7-10-14/h5-7,9-10,24H,3-4,8,11-13H2,1-2H3/p+2 |
| InChIKey | MVGKCAVFSGOXKR-UHFFFAOYSA-P |
| XLogP | 0.46 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|