C19H29NO3 — CID 144708761
methyl 7-[2-[(E)-hept-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 144708761) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is methyl 7-[2-[(E)-hept-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[2-[(E)-hept-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 144708761 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | methyl 7-[2-[(E)-hept-1-en-4-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CC/C=C/C1CCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C19H29NO3/c1-3-4-5-6-9-12-17-14-15-18(21)20(17)16-11-8-7-10-13-19(22)23-2/h9,12,17H,3,6-8,10-11,13-16H2,1-2H3/b12-9+ |
| InChIKey | MLAAJQBGNQCUDO-FMIVXFBMSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|