C25H47NO3 — CID 144708776
ethane;(E)-5-methylnon-2-en-7-yne;7-(2-oxopyrrolidin-1-yl)heptanoic acid (PubChem CID 144708776) has the molecular formula C25H47NO3 and a molecular weight of 409.66 g/mol. Its IUPAC name is ethane;(E)-5-methylnon-2-en-7-yne;7-(2-oxopyrrolidin-1-yl)heptanoic acid.
| Compound Name | ethane;(E)-5-methylnon-2-en-7-yne;7-(2-oxopyrrolidin-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 144708776 |
| Molecular Formula | C25H47NO3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.36 |
| IUPAC Name | ethane;(E)-5-methylnon-2-en-7-yne;7-(2-oxopyrrolidin-1-yl)heptanoic acid |
| SMILES | CC.CC.CC#CCC(C)C/C=C/C.O=C(O)CCCCCCN1CCCC1=O |
| InChI | InChI=1S/C11H19NO3.C10H16.2C2H6/c13-10-6-5-9-12(10)8-4-2-1-3-7-11(14)15;1-4-6-8-10(3)9-7-5-2;2*1-2/h1-9H2,(H,14,15);4,6,10H,8-9H2,1-3H3;2*1-2H3/b;6-4+;; |
| InChIKey | ZMPGDJUKMFZNPY-NGRWPUITSA-N |
| XLogP | 6.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|