C42H51N3O6 — CID 144709507
[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl (Z)-7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate (PubChem CID 144709507) has the molecular formula C42H51N3O6 and a molecular weight of 693.89 g/mol. Its IUPAC name is [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl (Z)-7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate.
| Compound Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl (Z)-7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 144709507 |
| Molecular Formula | C42H51N3O6 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl (Z)-7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
| SMILES | NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(COC(=O)CCC/C=C\C[C@H]2C(O)CC(O)[C@@H]2CCC(O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H51N3O6/c43-26-38(42(50)45-34-18-17-33-27-44-23-22-32(33)24-34)31-15-12-30(13-16-31)28-51-41(49)11-7-2-1-6-10-36-37(40(48)25-39(36)47)21-20-35(46)19-14-29-8-4-3-5-9-29/h1,3-6,8-9,12-13,15-18,22-24,27,35-40,46-48H,2,7,10-11,14,19-21,25-26,28,43H2,(H,45,50)/b6-1-/t35?,36-,37-,38?,39?,40?/m1/s1 |
| InChIKey | KUINCCADIITPAM-LPXIRQMCSA-N |
| XLogP | 6.21 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|