C29H34N6O3 — CID 144714854
5,11-bis[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one;(Z)-but-2-ene;ethane (PubChem CID 144714854) has the molecular formula C29H34N6O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is 5,11-bis[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one;(Z)-but-2-ene;ethane.
| Compound Name | 5,11-bis[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one;(Z)-but-2-ene;ethane |
|---|---|
| PubChem CID | 144714854 |
| Molecular Formula | C29H34N6O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 5,11-bis[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one;(Z)-but-2-ene;ethane |
| SMILES | C/C=C\C.CC.COc1ccc(Cn2c3ncnc4c(ncn4Cc4ccc(OC)cc4)c-3nc2=O)cc1 |
| InChI | InChI=1S/C23H20N6O3.C4H8.C2H6/c1-31-17-7-3-15(4-8-17)11-28-14-26-19-20-22(25-13-24-21(19)28)29(23(30)27-20)12-16-5-9-18(32-2)10-6-16;1-3-4-2;1-2/h3-10,13-14H,11-12H2,1-2H3;3-4H,1-2H3;1-2H3/b;4-3-; |
| InChIKey | KSNVBKCEBNIGIR-LWFKIUJUSA-N |
| XLogP | 5.21 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|