C21H14Cl2N6O — CID 46188047
5,11-bis[(4-chlorophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one (PubChem CID 46188047) has the molecular formula C21H14Cl2N6O and a molecular weight of 437.29 g/mol. Its IUPAC name is 5,11-bis[(4-chlorophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one.
| Compound Name | 5,11-bis[(4-chlorophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
|---|---|
| PubChem CID | 46188047 |
| Molecular Formula | C21H14Cl2N6O |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 5,11-bis[(4-chlorophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
| SMILES | O=c1nc2c3ncn(Cc4ccc(Cl)cc4)c3ncnc-2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl2N6O/c22-15-5-1-13(2-6-15)9-28-12-26-17-18-20(25-11-24-19(17)28)29(21(30)27-18)10-14-3-7-16(23)8-4-14/h1-8,11-12H,9-10H2 |
| InChIKey | UJQHPQVRMQTIPB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |