C26H21N12O+ — CID 91471829
7-methyl-5,11-bis[[4-(triazol-1-yl)phenyl]methyl]-3,5,9,11,13-pentaza-7-azoniatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one (PubChem CID 91471829) has the molecular formula C26H21N12O+ and a molecular weight of 517.54 g/mol. Its IUPAC name is 7-methyl-5,11-bis[[4-(triazol-1-yl)phenyl]methyl]-3,5,9,11,13-pentaza-7-azoniatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one.
| Compound Name | 7-methyl-5,11-bis[[4-(triazol-1-yl)phenyl]methyl]-3,5,9,11,13-pentaza-7-azoniatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
|---|---|
| PubChem CID | 91471829 |
| Molecular Formula | C26H21N12O+ |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 7-methyl-5,11-bis[[4-(triazol-1-yl)phenyl]methyl]-3,5,9,11,13-pentaza-7-azoniatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
| SMILES | C[n+]1cnc2c(ncn2Cc2ccc(-n3ccnn3)cc2)c2nc(=O)n(Cc3ccc(-n4ccnn4)cc3)c1-2 |
| InChI | InChI=1S/C26H21N12O/c1-34-16-28-24-22(27-17-35(24)14-18-2-6-20(7-3-18)37-12-10-29-32-37)23-25(34)36(26(39)31-23)15-19-4-8-21(9-5-19)38-13-11-30-33-38/h2-13,16-17H,14-15H2,1H3/q+1 |
| InChIKey | KJSGHUZQBZNPCP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 130.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|