C21H14I2N6O — CID 58503338
11-[(2-iodophenyl)methyl]-5-[(3-iodophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one (PubChem CID 58503338) has the molecular formula C21H14I2N6O and a molecular weight of 620.19 g/mol. Its IUPAC name is 11-[(2-iodophenyl)methyl]-5-[(3-iodophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one.
| Compound Name | 11-[(2-iodophenyl)methyl]-5-[(3-iodophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
|---|---|
| PubChem CID | 58503338 |
| Molecular Formula | C21H14I2N6O |
| Molecular Weight | 620.19 g/mol |
| Exact Mass | 619.93 |
| IUPAC Name | 11-[(2-iodophenyl)methyl]-5-[(3-iodophenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
| SMILES | O=c1nc2c3ncn(Cc4ccccc4I)c3ncnc-2n1Cc1cccc(I)c1 |
| InChI | InChI=1S/C21H14I2N6O/c22-15-6-3-4-13(8-15)9-29-20-18(27-21(29)30)17-19(24-11-25-20)28(12-26-17)10-14-5-1-2-7-16(14)23/h1-8,11-12H,9-10H2 |
| InChIKey | HYEZELZCFZMTEI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|