C7H14N2S — CID 144714959
2-(3,5-dimethyl-1,2-dihydroimidazol-2-yl)ethanethiol (PubChem CID 144714959) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-dihydroimidazol-2-yl)ethanethiol.
| Compound Name | 2-(3,5-dimethyl-1,2-dihydroimidazol-2-yl)ethanethiol |
|---|---|
| PubChem CID | 144714959 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-dihydroimidazol-2-yl)ethanethiol |
| SMILES | CC1=CN(C)C(CCS)N1 |
| InChI | InChI=1S/C7H14N2S/c1-6-5-9(2)7(8-6)3-4-10/h5,7-8,10H,3-4H2,1-2H3 |
| InChIKey | BOFPLCLMAGOTOT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|