C11H16FN5 — CID 144720446
4-[amino-(4-fluoro-2-pyridinyl)amino]-6-methyl-1,2,3,6-tetrahydropyridin-5-amine (PubChem CID 144720446) has the molecular formula C11H16FN5 and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-[amino-(4-fluoro-2-pyridinyl)amino]-6-methyl-1,2,3,6-tetrahydropyridin-5-amine.
| Compound Name | 4-[amino-(4-fluoro-2-pyridinyl)amino]-6-methyl-1,2,3,6-tetrahydropyridin-5-amine |
|---|---|
| PubChem CID | 144720446 |
| Molecular Formula | C11H16FN5 |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-[amino-(4-fluoro-2-pyridinyl)amino]-6-methyl-1,2,3,6-tetrahydropyridin-5-amine |
| SMILES | CC1NCCC(N(N)c2cc(F)ccn2)=C1N |
| InChI | InChI=1S/C11H16FN5/c1-7-11(13)9(3-5-15-7)17(14)10-6-8(12)2-4-16-10/h2,4,6-7,15H,3,5,13-14H2,1H3 |
| InChIKey | AMHLGJOZFRBSTM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|