C13H18F2N2O — CID 144725176
N'-[5-(difluoromethyl)-4-hydroxy-2-methylphenyl]-N-methyl-N-propylmethanimidamide (PubChem CID 144725176) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N'-[5-(difluoromethyl)-4-hydroxy-2-methylphenyl]-N-methyl-N-propylmethanimidamide.
| Compound Name | N'-[5-(difluoromethyl)-4-hydroxy-2-methylphenyl]-N-methyl-N-propylmethanimidamide |
|---|---|
| PubChem CID | 144725176 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N'-[5-(difluoromethyl)-4-hydroxy-2-methylphenyl]-N-methyl-N-propylmethanimidamide |
| SMILES | CCCN(C)/C=N/c1cc(C(F)F)c(O)cc1C |
| InChI | InChI=1S/C13H18F2N2O/c1-4-5-17(3)8-16-11-7-10(13(14)15)12(18)6-9(11)2/h6-8,13,18H,4-5H2,1-3H3/b16-8+ |
| InChIKey | WCPQJRKVPLWOHK-LZYBPNLTSA-N |
| XLogP | 3.64 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|