C21H38F2N2OSi2 — CID 141498795
N'-[4-[3,3-bis(trimethylsilyl)propoxy]-5-(difluoromethyl)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 141498795) has the molecular formula C21H38F2N2OSi2 and a molecular weight of 428.72 g/mol. Its IUPAC name is N'-[4-[3,3-bis(trimethylsilyl)propoxy]-5-(difluoromethyl)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[3,3-bis(trimethylsilyl)propoxy]-5-(difluoromethyl)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 141498795 |
| Molecular Formula | C21H38F2N2OSi2 |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N'-[4-[3,3-bis(trimethylsilyl)propoxy]-5-(difluoromethyl)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C(F)F)c(OCCC([Si](C)(C)C)[Si](C)(C)C)cc1C |
| InChI | InChI=1S/C21H38F2N2OSi2/c1-10-25(3)15-24-18-14-17(21(22)23)19(13-16(18)2)26-12-11-20(27(4,5)6)28(7,8)9/h13-15,20-21H,10-12H2,1-9H3/b24-15+ |
| InChIKey | TVIPCMLQFMEREB-BUVRLJJBSA-N |
| XLogP | 6.90 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|