C21H30N4OS — CID 155095419
N'-[2,5-dimethyl-4-[2-(3-methylbutylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 155095419) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[2-(3-methylbutylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[2-(3-methylbutylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 155095419 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N'-[2,5-dimethyl-4-[2-(3-methylbutylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2ccnc(SCCC(C)C)n2)cc1C |
| InChI | InChI=1S/C21H30N4OS/c1-7-25(6)14-23-18-12-17(5)19(13-16(18)4)26-20-8-10-22-21(24-20)27-11-9-15(2)3/h8,10,12-15H,7,9,11H2,1-6H3/b23-14+ |
| InChIKey | XNIMHPOKIGCUFG-OEAKJJBVSA-N |
| XLogP | 5.64 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|