C62H68 — CID 144730340
3-(2,7-ditert-butyl-9,9-dimethyl-8,8a-dihydrofluoren-4-yl)-8-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)fluoranthene (PubChem CID 144730340) has the molecular formula C62H68 and a molecular weight of 813.23 g/mol. Its IUPAC name is 3-(2,7-ditert-butyl-9,9-dimethyl-8,8a-dihydrofluoren-4-yl)-8-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)fluoranthene.
| Compound Name | 3-(2,7-ditert-butyl-9,9-dimethyl-8,8a-dihydrofluoren-4-yl)-8-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)fluoranthene |
|---|---|
| PubChem CID | 144730340 |
| Molecular Formula | C62H68 |
| Molecular Weight | 813.23 g/mol |
| Exact Mass | 812.53 |
| IUPAC Name | 3-(2,7-ditert-butyl-9,9-dimethyl-8,8a-dihydrofluoren-4-yl)-8-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)fluoranthene |
| SMILES | CC(C)(C)C1=CC=C2c3c(-c4ccc5c6c(cccc46)-c4cc(-c6cc(C(C)(C)C)cc7c6-c6ccc(C(C)(C)C)cc6C7(C)C)ccc4-5)cc(C(C)(C)C)cc3C(C)(C)C2C1 |
| InChI | InChI=1S/C62H68/c1-57(2,3)36-21-24-45-50(31-36)61(13,14)52-33-38(59(7,8)9)29-47(55(45)52)35-20-23-40-44-27-26-41(42-18-17-19-43(54(42)44)48(40)28-35)49-30-39(60(10,11)12)34-53-56(49)46-25-22-37(58(4,5)6)32-51(46)62(53,15)16/h17-31,33-34,51H,32H2,1-16H3 |
| InChIKey | UONLLKPLJMFBEU-UHFFFAOYSA-N |
| XLogP | 17.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.23 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |