C31H45N2O2P — CID 144733412
4-[[benzhydryl-(2,2,6,6-tetramethylcyclohexyl)amino]-butoxyphosphanyl]oxybutanenitrile (PubChem CID 144733412) has the molecular formula C31H45N2O2P and a molecular weight of 508.69 g/mol. Its IUPAC name is 4-[[benzhydryl-(2,2,6,6-tetramethylcyclohexyl)amino]-butoxyphosphanyl]oxybutanenitrile.
| Compound Name | 4-[[benzhydryl-(2,2,6,6-tetramethylcyclohexyl)amino]-butoxyphosphanyl]oxybutanenitrile |
|---|---|
| PubChem CID | 144733412 |
| Molecular Formula | C31H45N2O2P |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 4-[[benzhydryl-(2,2,6,6-tetramethylcyclohexyl)amino]-butoxyphosphanyl]oxybutanenitrile |
| SMILES | CCCCOP(OCCCC#N)N(C(c1ccccc1)c1ccccc1)C1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C31H45N2O2P/c1-6-7-24-34-36(35-25-15-14-23-32)33(29-30(2,3)21-16-22-31(29,4)5)28(26-17-10-8-11-18-26)27-19-12-9-13-20-27/h8-13,17-20,28-29H,6-7,14-16,21-22,24-25H2,1-5H3 |
| InChIKey | RPOLINOIAQWTRA-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|