C11H13F2N3O4S — CID 144743988
2,3-difluoro-4-[(3-sulfamoylpropanoylamino)methyl]benzamide (PubChem CID 144743988) has the molecular formula C11H13F2N3O4S and a molecular weight of 321.31 g/mol. Its IUPAC name is 2,3-difluoro-4-[(3-sulfamoylpropanoylamino)methyl]benzamide.
| Compound Name | 2,3-difluoro-4-[(3-sulfamoylpropanoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 144743988 |
| Molecular Formula | C11H13F2N3O4S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2,3-difluoro-4-[(3-sulfamoylpropanoylamino)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CNC(=O)CCS(N)(=O)=O)c(F)c1F |
| InChI | InChI=1S/C11H13F2N3O4S/c12-9-6(1-2-7(10(9)13)11(14)18)5-16-8(17)3-4-21(15,19)20/h1-2H,3-5H2,(H2,14,18)(H,16,17)(H2,15,19,20) |
| InChIKey | YRVZWGZQZYOFKC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |