C23H29F3N4O2S — CID 144744588
cyanamide;ethane;3-methyl-2-N-(1-methylsulfanylpropan-2-yl)-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide (PubChem CID 144744588) has the molecular formula C23H29F3N4O2S and a molecular weight of 482.57 g/mol. Its IUPAC name is cyanamide;ethane;3-methyl-2-N-(1-methylsulfanylpropan-2-yl)-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide.
| Compound Name | cyanamide;ethane;3-methyl-2-N-(1-methylsulfanylpropan-2-yl)-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 144744588 |
| Molecular Formula | C23H29F3N4O2S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | cyanamide;ethane;3-methyl-2-N-(1-methylsulfanylpropan-2-yl)-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide |
| SMILES | CC.CSCC(C)NC(=O)c1c(C)cccc1C(=O)Nc1cccc(C(F)(F)F)c1.N#CN |
| InChI | InChI=1S/C20H21F3N2O2S.C2H6.CH2N2/c1-12-6-4-9-16(17(12)19(27)24-13(2)11-28-3)18(26)25-15-8-5-7-14(10-15)20(21,22)23;1-2;2-1-3/h4-10,13H,11H2,1-3H3,(H,24,27)(H,25,26);1-2H3;2H2 |
| InChIKey | LAIVLNXUVSOPGE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|