C21H21F3N4O2S — CID 123270019
2-N-[1-(N-cyano-S-methylsulfinimidoyl)propan-2-yl]-3-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide (PubChem CID 123270019) has the molecular formula C21H21F3N4O2S and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-N-[1-(N-cyano-S-methylsulfinimidoyl)propan-2-yl]-3-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide.
| Compound Name | 2-N-[1-(N-cyano-S-methylsulfinimidoyl)propan-2-yl]-3-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 123270019 |
| Molecular Formula | C21H21F3N4O2S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-N-[1-(N-cyano-S-methylsulfinimidoyl)propan-2-yl]-3-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,2-dicarboxamide |
| SMILES | Cc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1C(=O)NC(C)C/S(C)=N/C#N |
| InChI | InChI=1S/C21H21F3N4O2S/c1-13-6-4-9-17(18(13)20(30)27-14(2)11-31(3)26-12-25)19(29)28-16-8-5-7-15(10-16)21(22,23)24/h4-10,14H,11H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | GZEZFFKEHFOWBP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|