methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid

C11H14BF3O2 — CID 144744690

IUPACmethane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid
SMILESC.CC=COB(O)c1cccc(C(F)(F)F)c1
InChIInChI=1S/C10H10BF3O2.CH4/c1-2-6-16-11(15)9-5-3-4-8(7-9)10(12,13)14;/h2-7,15H,1H3;1H4
InChIKeyVVKGNSNRQZQNKW-UHFFFAOYSA-N
MW246.04 g/mol
LogP2.58
Rot. Bonds3

About methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid

methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid (PubChem CID 144744690) has the molecular formula C11H14BF3O2 and a molecular weight of 246.04 g/mol. Its IUPAC name is methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid.

Molecular Properties

Compound Namemethane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid
PubChem CID144744690
Molecular FormulaC11H14BF3O2
Molecular Weight246.04 g/mol
Exact Mass246.10
IUPAC Namemethane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid
SMILESC.CC=COB(O)c1cccc(C(F)(F)F)c1
InChIInChI=1S/C10H10BF3O2.CH4/c1-2-6-16-11(15)9-5-3-4-8(7-9)10(12,13)14;/h2-7,15H,1H3;1H4
InChIKeyVVKGNSNRQZQNKW-UHFFFAOYSA-N
XLogP2.58
TPSA29.46 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.04
LogP ≤ 52.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
The IUPAC name of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid (CID 144744690) is methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid.
What is the SMILES notation for methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
The canonical SMILES for methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid is C.CC=COB(O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
The InChIKey is VVKGNSNRQZQNKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BF3O2.CH4/c1-2-6-16-11(15)9-5-3-4-8(7-9)10(12,13)14;/h2-7,15H,1H3;1H4.
What are the key properties of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid has a molecular weight of 246.04 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid is sourced from PubChem (CID 144744690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).