About methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid
methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid (PubChem CID 144744690) has the molecular formula C11H14BF3O2
and a molecular weight of 246.04 g/mol. Its IUPAC name is methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid.
Molecular Properties
| Compound Name | methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid |
| PubChem CID | 144744690 |
| Molecular Formula | C11H14BF3O2 |
| Molecular Weight | 246.04 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid |
| SMILES | C.CC=COB(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10BF3O2.CH4/c1-2-6-16-11(15)9-5-3-4-8(7-9)10(12,13)14;/h2-7,15H,1H3;1H4 |
| InChIKey | VVKGNSNRQZQNKW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.04 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
The IUPAC name of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid (CID 144744690) is methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid.
What is the SMILES notation for methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
The canonical SMILES for methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid is C.CC=COB(O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
The InChIKey is VVKGNSNRQZQNKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BF3O2.CH4/c1-2-6-16-11(15)9-5-3-4-8(7-9)10(12,13)14;/h2-7,15H,1H3;1H4.
What are the key properties of methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid?
methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid has a molecular weight of 246.04 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;prop-1-enoxy-[3-(trifluoromethyl)phenyl]borinic acid is sourced from PubChem (CID 144744690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).