C23H24FN3OS2 — CID 144744809
6-[4-[2-fluoro-5-[1-(1,3-thiazol-2-yl)ethyl]phenyl]thieno[3,2-d]pyrimidin-6-yl]hexan-1-ol (PubChem CID 144744809) has the molecular formula C23H24FN3OS2 and a molecular weight of 441.60 g/mol. Its IUPAC name is 6-[4-[2-fluoro-5-[1-(1,3-thiazol-2-yl)ethyl]phenyl]thieno[3,2-d]pyrimidin-6-yl]hexan-1-ol.
| Compound Name | 6-[4-[2-fluoro-5-[1-(1,3-thiazol-2-yl)ethyl]phenyl]thieno[3,2-d]pyrimidin-6-yl]hexan-1-ol |
|---|---|
| PubChem CID | 144744809 |
| Molecular Formula | C23H24FN3OS2 |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 6-[4-[2-fluoro-5-[1-(1,3-thiazol-2-yl)ethyl]phenyl]thieno[3,2-d]pyrimidin-6-yl]hexan-1-ol |
| SMILES | CC(c1ccc(F)c(-c2ncnc3cc(CCCCCCO)sc23)c1)c1nccs1 |
| InChI | InChI=1S/C23H24FN3OS2/c1-15(23-25-9-11-29-23)16-7-8-19(24)18(12-16)21-22-20(26-14-27-21)13-17(30-22)6-4-2-3-5-10-28/h7-9,11-15,28H,2-6,10H2,1H3 |
| InChIKey | MEBKJQQFMRJYNW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|