C26H24FN3OS2 — CID 144744923
2-[3-[6-[[(1E)-cycloocten-1-yl]methyl]thieno[3,2-d]pyrimidin-4-yl]-4-fluorophenyl]-2-(1,3-thiazol-2-yl)acetaldehyde (PubChem CID 144744923) has the molecular formula C26H24FN3OS2 and a molecular weight of 477.63 g/mol. Its IUPAC name is 2-[3-[6-[[(1E)-cycloocten-1-yl]methyl]thieno[3,2-d]pyrimidin-4-yl]-4-fluorophenyl]-2-(1,3-thiazol-2-yl)acetaldehyde.
| Compound Name | 2-[3-[6-[[(1E)-cycloocten-1-yl]methyl]thieno[3,2-d]pyrimidin-4-yl]-4-fluorophenyl]-2-(1,3-thiazol-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 144744923 |
| Molecular Formula | C26H24FN3OS2 |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-[3-[6-[[(1E)-cycloocten-1-yl]methyl]thieno[3,2-d]pyrimidin-4-yl]-4-fluorophenyl]-2-(1,3-thiazol-2-yl)acetaldehyde |
| SMILES | O=CC(c1ccc(F)c(-c2ncnc3cc(C/C4=C/CCCCCC4)sc23)c1)c1nccs1 |
| InChI | InChI=1S/C26H24FN3OS2/c27-22-9-8-18(21(15-31)26-28-10-11-32-26)13-20(22)24-25-23(29-16-30-24)14-19(33-25)12-17-6-4-2-1-3-5-7-17/h6,8-11,13-16,21H,1-5,7,12H2/b17-6+ |
| InChIKey | FQGZXTMIIVMYRW-UBKPWBPPSA-N |
| XLogP | 7.11 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|