C16H23NO4 — CID 144745833
3-methyl-1-[2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl]pyrrole-2,5-dione (PubChem CID 144745833) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-methyl-1-[2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 144745833 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-methyl-1-[2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl]pyrrole-2,5-dione |
| SMILES | C=CC(=O)C(C)(C)OCCC(C)(C)N1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C16H23NO4/c1-7-12(18)16(5,6)21-9-8-15(3,4)17-13(19)10-11(2)14(17)20/h7,10H,1,8-9H2,2-6H3 |
| InChIKey | RVGREAJOJNWBNY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|