C10H14N2O3 — CID 106096968
3-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide (PubChem CID 106096968) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide.
| Compound Name | 3-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 106096968 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide |
| SMILES | CC1=CC(=O)N(C(C)(C)CC(N)=O)C1=O |
| InChI | InChI=1S/C10H14N2O3/c1-6-4-8(14)12(9(6)15)10(2,3)5-7(11)13/h4H,5H2,1-3H3,(H2,11,13) |
| InChIKey | GBYSKWRLCBZZCW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|