C25H36N2O5 — CID 147536571
[2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl] 3-[4-(4-formylphenyl)piperazin-1-yl]propanoate (PubChem CID 147536571) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is [2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl] 3-[4-(4-formylphenyl)piperazin-1-yl]propanoate.
| Compound Name | [2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl] 3-[4-(4-formylphenyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 147536571 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | [2-methyl-4-(2-methyl-3-oxopent-4-en-2-yl)oxybutan-2-yl] 3-[4-(4-formylphenyl)piperazin-1-yl]propanoate |
| SMILES | C=CC(=O)C(C)(C)OCCC(C)(C)OC(=O)CCN1CCN(c2ccc(C=O)cc2)CC1 |
| InChI | InChI=1S/C25H36N2O5/c1-6-22(29)25(4,5)31-18-12-24(2,3)32-23(30)11-13-26-14-16-27(17-15-26)21-9-7-20(19-28)8-10-21/h6-10,19H,1,11-18H2,2-5H3 |
| InChIKey | FOBQVJQWYUGJIM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|