C17H26N2O3 — CID 144746977
benzyl carbamate;(Z)-N-cyclopropylhex-2-enamide;molecular hydrogen (PubChem CID 144746977) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is benzyl carbamate;(Z)-N-cyclopropylhex-2-enamide;molecular hydrogen.
| Compound Name | benzyl carbamate;(Z)-N-cyclopropylhex-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 144746977 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | benzyl carbamate;(Z)-N-cyclopropylhex-2-enamide;molecular hydrogen |
| SMILES | CCC/C=C\C(=O)NC1CC1.NC(=O)OCc1ccccc1.[H][H] |
| InChI | InChI=1S/C9H15NO.C8H9NO2.H2/c1-2-3-4-5-9(11)10-8-6-7-8;9-8(10)11-6-7-4-2-1-3-5-7;/h4-5,8H,2-3,6-7H2,1H3,(H,10,11);1-5H,6H2,(H2,9,10);1H/b5-4-;; |
| InChIKey | RGOCNZDHOUWKSS-WNCVTPEDSA-N |
| XLogP | 3.15 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|