C17H17N3O5S2 — CID 144749011
ethyl N-[2-[[hydroxy-(5-methoxy-1,3-benzothiazol-2-yl)methyl]amino]thiophene-3-carbonyl]carbamate (PubChem CID 144749011) has the molecular formula C17H17N3O5S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl N-[2-[[hydroxy-(5-methoxy-1,3-benzothiazol-2-yl)methyl]amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[[hydroxy-(5-methoxy-1,3-benzothiazol-2-yl)methyl]amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 144749011 |
| Molecular Formula | C17H17N3O5S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | ethyl N-[2-[[hydroxy-(5-methoxy-1,3-benzothiazol-2-yl)methyl]amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(O)c1nc2cc(OC)ccc2s1 |
| InChI | InChI=1S/C17H17N3O5S2/c1-3-25-17(23)20-13(21)10-6-7-26-15(10)19-14(22)16-18-11-8-9(24-2)4-5-12(11)27-16/h4-8,14,19,22H,3H2,1-2H3,(H,20,21,23) |
| InChIKey | HXMOEMCOVFQMDE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|