C21H16F3N5 — CID 144751735
(Z)-3-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-[5-methyl-2-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 144751735) has the molecular formula C21H16F3N5 and a molecular weight of 395.39 g/mol. Its IUPAC name is (Z)-3-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-[5-methyl-2-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-[5-methyl-2-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 144751735 |
| Molecular Formula | C21H16F3N5 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (Z)-3-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-[5-methyl-2-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | [H]/N=C/C(=C\N)c1cnc2[nH]cc(/C=C(\C#N)c3cc(C)ccc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C21H16F3N5/c1-12-2-3-19(21(22,23)24)17(4-12)13(7-25)5-15-11-29-20-18(15)6-14(10-28-20)16(8-26)9-27/h2-6,8-11,26H,27H2,1H3,(H,28,29)/b13-5+,16-9+,26-8+ |
| InChIKey | QUXQZHOHZDEIQQ-MUIJITHJSA-N |
| XLogP | 4.90 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|