C24H21ClF3N5 — CID 147341749
2-[3-[2-[5-chloro-2-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-piperidin-4-yliminoprop-1-en-1-amine (PubChem CID 147341749) has the molecular formula C24H21ClF3N5 and a molecular weight of 471.91 g/mol. Its IUPAC name is 2-[3-[2-[5-chloro-2-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-piperidin-4-yliminoprop-1-en-1-amine.
| Compound Name | 2-[3-[2-[5-chloro-2-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-piperidin-4-yliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 147341749 |
| Molecular Formula | C24H21ClF3N5 |
| Molecular Weight | 471.91 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-[3-[2-[5-chloro-2-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-piperidin-4-yliminoprop-1-en-1-amine |
| SMILES | NC=C(/C=N/C1CCNCC1)c1cnc2[nH]cc(C#Cc3cc(Cl)ccc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C24H21ClF3N5/c25-19-3-4-22(24(26,27)28)15(9-19)1-2-16-12-32-23-21(16)10-17(13-33-23)18(11-29)14-31-20-5-7-30-8-6-20/h3-4,9-14,20,30H,5-8,29H2,(H,32,33)/b18-11?,31-14+ |
| InChIKey | VDPWYDDWZWDKHO-KBSQENOHSA-N |
| XLogP | 4.76 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|