C13H24N4 — CID 144752647
butane;ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 144752647) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is butane;ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | butane;ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144752647 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | butane;ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC.CCCC.Cc1c[nH]c2ncnc(N)c12 |
| InChI | InChI=1S/C7H8N4.C4H10.C2H6/c1-4-2-9-7-5(4)6(8)10-3-11-7;1-3-4-2;1-2/h2-3H,1H3,(H3,8,9,10,11);3-4H2,1-2H3;1-2H3 |
| InChIKey | BOTJVQPEECMLOT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |