C13H19KN4O2 — CID 156857458
potassium;methanidyloxymethane;5-[(E)-3-methoxybut-2-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156857458) has the molecular formula C13H19KN4O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is potassium;methanidyloxymethane;5-[(E)-3-methoxybut-2-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | potassium;methanidyloxymethane;5-[(E)-3-methoxybut-2-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156857458 |
| Molecular Formula | C13H19KN4O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | potassium;methanidyloxymethane;5-[(E)-3-methoxybut-2-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CO/C(C)=C/Cc1c[nH]c2ncnc(N)c12.[CH2-]OC.[K+] |
| InChI | InChI=1S/C11H14N4O.C2H5O.K/c1-7(16-2)3-4-8-5-13-11-9(8)10(12)14-6-15-11;1-3-2;/h3,5-6H,4H2,1-2H3,(H3,12,13,14,15);1H2,2H3;/q;-1;+1/b7-3+;; |
| InChIKey | PMKZEFZUIKOAIA-BABLKGGBSA-N |
| XLogP | -0.94 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|