C35H48N3S+ — CID 144754157
[9-[4-(dibutylamino)phenyl]-6-(diethylamino)thioxanthen-3-ylidene]-diethylazanium (PubChem CID 144754157) has the molecular formula C35H48N3S+ and a molecular weight of 542.86 g/mol. Its IUPAC name is [9-[4-(dibutylamino)phenyl]-6-(diethylamino)thioxanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-(dibutylamino)phenyl]-6-(diethylamino)thioxanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 144754157 |
| Molecular Formula | C35H48N3S+ |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | [9-[4-(dibutylamino)phenyl]-6-(diethylamino)thioxanthen-3-ylidene]-diethylazanium |
| SMILES | CCCCN(CCCC)c1ccc(-c2c3ccc(=[N+](CC)CC)cc-3sc3cc(N(CC)CC)ccc23)cc1 |
| InChI | InChI=1S/C35H48N3S/c1-7-13-23-38(24-14-8-2)28-17-15-27(16-18-28)35-31-21-19-29(36(9-3)10-4)25-33(31)39-34-26-30(20-22-32(34)35)37(11-5)12-6/h15-22,25-26H,7-14,23-24H2,1-6H3/q+1 |
| InChIKey | KFPIOQIXRYXOQD-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|