C34H51N4O+ — CID 139325258
[6-(diethylamino)-9-[(1Z,3Z)-1-[3-(diethylamino)propyl-methylamino]penta-1,3-dienyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 139325258) has the molecular formula C34H51N4O+ and a molecular weight of 531.81 g/mol. Its IUPAC name is [6-(diethylamino)-9-[(1Z,3Z)-1-[3-(diethylamino)propyl-methylamino]penta-1,3-dienyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[(1Z,3Z)-1-[3-(diethylamino)propyl-methylamino]penta-1,3-dienyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 139325258 |
| Molecular Formula | C34H51N4O+ |
| Molecular Weight | 531.81 g/mol |
| Exact Mass | 531.41 |
| IUPAC Name | [6-(diethylamino)-9-[(1Z,3Z)-1-[3-(diethylamino)propyl-methylamino]penta-1,3-dienyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | C/C=C\C=C(\c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12)N(C)CCCN(CC)CC |
| InChI | InChI=1S/C34H51N4O/c1-9-16-18-31(35(8)23-17-24-36(10-2)11-3)34-29-21-19-27(37(12-4)13-5)25-32(29)39-33-26-28(20-22-30(33)34)38(14-6)15-7/h9,16,18-22,25-26H,10-15,17,23-24H2,1-8H3/q+1/b16-9-,31-18- |
| InChIKey | RPXTTXXRYDPMOD-ISLINPKHSA-N |
| XLogP | 6.78 |
| TPSA | 25.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.81 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|