C10H20N2 — CID 144754768
N'-[(1Z)-buta-1,3-dienyl]butanimidamide;ethane (PubChem CID 144754768) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-[(1Z)-buta-1,3-dienyl]butanimidamide;ethane.
| Compound Name | N'-[(1Z)-buta-1,3-dienyl]butanimidamide;ethane |
|---|---|
| PubChem CID | 144754768 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-[(1Z)-buta-1,3-dienyl]butanimidamide;ethane |
| SMILES | C=C/C=C\N=C(\N)CCC.CC |
| InChI | InChI=1S/C8H14N2.C2H6/c1-3-5-7-10-8(9)6-4-2;1-2/h3,5,7H,1,4,6H2,2H3,(H2,9,10);1-2H3/b7-5-; |
| InChIKey | RGSSIINQJWWMNE-YJOCEBFMSA-N |
| XLogP | 2.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|