C14H17BrF2N4O2 — CID 144756194
tert-butyl N-[(2R)-1-azido-2-(5-bromo-2,3-difluorophenyl)propan-2-yl]carbamate (PubChem CID 144756194) has the molecular formula C14H17BrF2N4O2 and a molecular weight of 391.22 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-azido-2-(5-bromo-2,3-difluorophenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-azido-2-(5-bromo-2,3-difluorophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 144756194 |
| Molecular Formula | C14H17BrF2N4O2 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | tert-butyl N-[(2R)-1-azido-2-(5-bromo-2,3-difluorophenyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@](C)(CN=[N+]=[N-])c1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C14H17BrF2N4O2/c1-13(2,3)23-12(22)20-14(4,7-19-21-18)9-5-8(15)6-10(16)11(9)17/h5-6H,7H2,1-4H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | CNFCFPIPSOHTJO-AWEZNQCLSA-N |
| XLogP | 4.78 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|