C20H20BrF4NO4 — CID 159677446
5-bromo-2,3-difluorobenzaldehyde;tert-butyl N-(3,4-difluoro-5-formylphenyl)carbamate;methane (PubChem CID 159677446) has the molecular formula C20H20BrF4NO4 and a molecular weight of 494.28 g/mol. Its IUPAC name is 5-bromo-2,3-difluorobenzaldehyde;tert-butyl N-(3,4-difluoro-5-formylphenyl)carbamate;methane.
| Compound Name | 5-bromo-2,3-difluorobenzaldehyde;tert-butyl N-(3,4-difluoro-5-formylphenyl)carbamate;methane |
|---|---|
| PubChem CID | 159677446 |
| Molecular Formula | C20H20BrF4NO4 |
| Molecular Weight | 494.28 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 5-bromo-2,3-difluorobenzaldehyde;tert-butyl N-(3,4-difluoro-5-formylphenyl)carbamate;methane |
| SMILES | C.CC(C)(C)OC(=O)Nc1cc(F)c(F)c(C=O)c1.O=Cc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C12H13F2NO3.C7H3BrF2O.CH4/c1-12(2,3)18-11(17)15-8-4-7(6-16)10(14)9(13)5-8;8-5-1-4(3-11)7(10)6(9)2-5;/h4-6H,1-3H3,(H,15,17);1-3H;1H4 |
| InChIKey | MUUAJKIFWWOUGU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|