C14H18FNO2 — CID 178053772
tert-butyl N-(3-ethenyl-4-fluoro-5-methylphenyl)carbamate (PubChem CID 178053772) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is tert-butyl N-(3-ethenyl-4-fluoro-5-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(3-ethenyl-4-fluoro-5-methylphenyl)carbamate |
|---|---|
| PubChem CID | 178053772 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | tert-butyl N-(3-ethenyl-4-fluoro-5-methylphenyl)carbamate |
| SMILES | C=Cc1cc(NC(=O)OC(C)(C)C)cc(C)c1F |
| InChI | InChI=1S/C14H18FNO2/c1-6-10-8-11(7-9(2)12(10)15)16-13(17)18-14(3,4)5/h6-8H,1H2,2-5H3,(H,16,17) |
| InChIKey | CYYIGNHZZXPLKM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |